What is the PubChem CID of cholesteryl acetate?
The PubChem CID of cholesteryl acetate is 2723897.
What is the molecular formula of cholesteryl acetate?
The molecular formula of cholesteryl acetate is C29H48O2.
What is the molecular weight of cholesteryl acetate?
The molecular weight of cholesteryl acetate is 428.7 g/mol.
What is the IUPAC name of cholesteryl acetate?
The IUPAC name of cholesteryl acetate is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
What is the InChI of cholesteryl acetate?
The InChI of cholesteryl acetate is InChI=1S/C29H48O2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(31-21(4)30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-20,23-27H,7-9,11-18H2,1-6H3/t20-,23+,24-,25-,26+,27+,28+,29-/m1/s1.
What is the InChIKey of cholesteryl acetate?
The InChIKey of cholesteryl acetate is XUGISPSHIFXEHZ-VEVYEIKRSA-N.
What is the canonical SMILES of cholesteryl acetate?
The canonical SMILES of cholesteryl acetate is CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C.
What is the CAS number of cholesteryl acetate?
The CAS number of cholesteryl acetate is 604-35-3.
What is the UNII of cholesteryl acetate?
The UNII of cholesteryl acetate is OTA9A3781T.
What is the ChEMBL ID of cholesteryl acetate?
The ChEMBL ID of cholesteryl acetate is CHEMBL3138728.