What is the PubChem CID of chlorohydroquinone?
PubChem CID 301.
What is the molecular formula of chlorohydroquinone?
The molecular formula is C6H5ClO2.
What is the molecular weight of chlorohydroquinone?
The molecular weight is 144.55 g/mol.
What is the IUPAC name of chlorohydroquinone?
The IUPAC name is 2-chlorobenzene-1,4-diol.
What is the InChI of chlorohydroquinone?
The InChI is InChI=1S/C6H5ClO2/c7-5-3-4(8)1-2-6(5)9/h1-3,8-9H.
What is the InChIKey of chlorohydroquinone?
The InChIKey is AJPXTSMULZANCB-UHFFFAOYSA-N.
What is the canonical SMILES of chlorohydroquinone?
The canonical SMILES is C1=CC(=C(C=C1O)Cl)O.
What is the CAS number of chlorohydroquinone?
The CAS number is 615-67-8.
What is the EC number of chlorohydroquinone?
The EC number is 210-442-8.