What is the molecular formula of butenafine hydrochloride?
The molecular formula of butenafine hydrochloride is C23H28ClN.
What is the molecular weight of butenafine hydrochloride?
The molecular weight of butenafine hydrochloride is 353.9 g/mol.
What is the parent compound of butenafine hydrochloride?
The parent compound of butenafine hydrochloride is Butenafine.
What are the component compounds of butenafine hydrochloride?
The component compounds of butenafine hydrochloride are Hydrochloric Acid and Butenafine.
What is the role of butenafine hydrochloride as per the reference?
Butenafine hydrochloride is an inhibitor of squalene epoxidase, an enzyme responsible for the creation of sterols needed in fungal cell membranes, and is used for the treatment of dermatological fungal infections.
What is the IUPAC name of butenafine hydrochloride derived by Lexichem TK 2.7.0?
The IUPAC name of butenafine hydrochloride derived by Lexichem TK 2.7.0 is 1-(4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanamine;hydrochloride.
What is the InChIKey of butenafine hydrochloride as computed by InChI 1.0.6?
The InChIKey of butenafine hydrochloride computed by InChI 1.0.6 is LJBSAUIFGPSHCN-UHFFFAOYSA-N.
What is the Canonical SMILES of butenafine hydrochloride as computed by OEChem 2.3.0?
The Canonical SMILES of butenafine hydrochloride computed by OEChem 2.3.0 is CC(C)(C)C1=CC=C(C=C1)CN(C)CC2=CC=CC3=CC=CC=C32.Cl.
What is the CAS number of butenafine hydrochloride?
The CAS number of butenafine hydrochloride is 101827-46-7.
What are the synonyms for butenafine hydrochloride?
The synonyms for butenafine hydrochloride include Butenafine HCL, Mentax, and KP-363.