What is the molecular formula of Bromomaleic anhydride?
The molecular formula of Bromomaleic anhydride is C4HBrO3.
What is the molecular weight of Bromomaleic anhydride?
The molecular weight of Bromomaleic anhydride is 176.95 g/mol.
What is the IUPAC name of Bromomaleic anhydride?
The IUPAC name of Bromomaleic anhydride is 3-bromofuran-2,5-dione.
What is the InChI of Bromomaleic anhydride?
The InChI of Bromomaleic anhydride is InChI=1S/C4HBrO3/c5-2-1-3(6)8-4(2)7/h1H.
What is the InChIKey of Bromomaleic anhydride?
The InChIKey of Bromomaleic anhydride is YPRMWCKXOZFJGF-UHFFFAOYSA-N.
What is the canonical SMILES of Bromomaleic anhydride?
The canonical SMILES of Bromomaleic anhydride is C1=C(C(=O)OC1=O)Br.
What is the CAS number of Bromomaleic anhydride?
The CAS number of Bromomaleic anhydride is 5926-51-2.
What is the ChEMBL ID of Bromomaleic anhydride?
The ChEMBL ID of Bromomaleic anhydride is CHEMBL2270555.
What is the XLogP3-AA value of Bromomaleic anhydride?
The XLogP3-AA value of Bromomaleic anhydride is 0.8.
How many hydrogen bond acceptor counts does Bromomaleic anhydride have?
Bromomaleic anhydride has 3 hydrogen bond acceptor counts.