What is the PubChem CID of the compound?
The PubChem CID of the compound is 59629382.
What is the molecular formula of the compound?
The molecular formula of the compound is C56H38N4.
What are the synonyms of the compound?
The synonyms of the compound are 1009033-94-6, 3,3',5,5'-Tetrakis[3-(3-pyridyl)phenyl]-1,1'-biphenyl, Bp4mpy, 3-[3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine, BP4MPy, and 3,3',5,5'-tetra[(M-pyridyl)-phen-3-yl]biphenyl.
What is the molecular weight of the compound?
The molecular weight of the compound is 766.9 g/mol.
When was the compound created and modified in PubChem?
The compound was created on 2012-08-20 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-[3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C56H38N4/c1-9-39(47-17-5-21-57-35-47)25-43(13-1)51-29-52(44-14-2-10-40(26-44)48-18-6-22-58-36-48)32-55(31-51)56-33-53(45-15-3-11-41(27-45)49-19-7-23-59-37-49)30-54(34-56)46-16-4-12-42(28-46)50-20-8-24-60-38-50/h1-38H.
What is the InChIKey of the compound?
The InChIKey of the compound is JOWLUTHJWQYFOH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC(=C1)C2=CC(=CC(=C2)C3=CC(=CC(=C3)C4=CC=CC(=C4)C5=CN=CC=C5)C6=CC=CC(=C6)C7=CN=CC=C7)C8=CC=CC(=C8)C9=CN=CC=C9)C1=CN=CC=C1.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.