What is the molecular formula of Bis(methyldiethoxysilylpropyl)amine?
The molecular formula of Bis(methyldiethoxysilylpropyl)amine is C16H39NO4Si2.
What is the molecular weight of Bis(methyldiethoxysilylpropyl)amine?
The molecular weight of Bis(methyldiethoxysilylpropyl)amine is 365.66 g/mol.
What is the IUPAC name of Bis(methyldiethoxysilylpropyl)amine?
The IUPAC name of Bis(methyldiethoxysilylpropyl)amine is 3-[diethoxy(methyl)silyl]-N-[3-[diethoxy(methyl)silyl]propyl]propan-1-amine.
What is the InChI of Bis(methyldiethoxysilylpropyl)amine?
The InChI of Bis(methyldiethoxysilylpropyl)amine is InChI=1S/C16H39NO4Si2/c1-7-18-22(5,19-8-2)15-11-13-17-14-12-16-23(6,20-9-3)21-10-4/h17H,7-16H2,1-6H3.
What is the InChIKey of Bis(methyldiethoxysilylpropyl)amine?
The InChIKey of Bis(methyldiethoxysilylpropyl)amine is SUKDLHIPTSZFPO-UHFFFAOYSA-N.
What is the canonical SMILES of Bis(methyldiethoxysilylpropyl)amine?
The canonical SMILES of Bis(methyldiethoxysilylpropyl)amine is CCO[Si](C)(CCCNCCC[Si](C)(OCC)OCC).
What is the CAS number of Bis(methyldiethoxysilylpropyl)amine?
The CAS number of Bis(methyldiethoxysilylpropyl)amine is 31020-47-0.
What is the European Community (EC) number of Bis(methyldiethoxysilylpropyl)amine?
The European Community (EC) number of Bis(methyldiethoxysilylpropyl)amine is 696-287-0.
What is the hydrogen bond donor count of Bis(methyldiethoxysilylpropyl)amine?
The hydrogen bond donor count of Bis(methyldiethoxysilylpropyl)amine is 1.
What is the hydrogen bond acceptor count of Bis(methyldiethoxysilylpropyl)amine?
The hydrogen bond acceptor count of Bis(methyldiethoxysilylpropyl)amine is 5.
※ Please kindly note that our products are for research use only.