What is the molecular formula of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The molecular formula is C30H56N2O4.
What is the molecular weight of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The molecular weight is 508.8 g/mol.
What is the IUPAC name of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate.
What is the InChI of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The InChI is InChI=1S/C30H56N2O4/c1-27(2)19-23(20-28(3,4)31(27)9)35-25(33)17-15-13-11-12-14-16-18-26(34)36-24-21-29(5,6)32(10)30(7,8)22-24/h23-24H,11-22H2,1-10H3.
What is the InChIKey of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The InChIKey is RSOILICUEWXSLA-UHFFFAOYSA-N.
What is the canonical SMILES of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The canonical SMILES is CC1(CC(CC(N1C)(C)C)OC(=O)CCCCCCCCC(=O)OC2CC(N(C(C2)(C)C)C)(C)C).
What is the CAS number of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
The CAS number is 41556-26-7.
What is the molecular weight of Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate according to PubChem?
The molecular weight is 508.8 g/mol.
How many hydrogen bond acceptors are there in Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
There are 6 hydrogen bond acceptors.
How many rotatable bonds are there in Bis(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate?
There are 13 rotatable bonds.
※ Please kindly note that our products are for research use only.