What is the PubChem CID for Benzyl glycidyl ether?
PubChem CID 94247
What is the molecular formula of Benzyl glycidyl ether?
The molecular formula is C10H12O2.
What is the molecular weight of Benzyl glycidyl ether?
The molecular weight is 164.20 g/mol.
What is the IUPAC name of Benzyl glycidyl ether?
The IUPAC name is 2-(phenylmethoxymethyl)oxirane.
What is the InChI of Benzyl glycidyl ether?
The InChI is InChI=1S/C10H12O2/c1-2-4-9(5-3-1)6-11-7-10-8-12-10/h1-5,10H,6-8H2.
What is the InChIKey of Benzyl glycidyl ether?
The InChIKey is QNYBOILAKBSWFG-UHFFFAOYSA-N.
What is the Canonical SMILES of Benzyl glycidyl ether?
The Canonical SMILES is C1C(O1)COCC2=CC=CC=C2.
What is the CAS number of Benzyl glycidyl ether?
The CAS number is 2930-05-4.
What is the European Community (EC) Number of Benzyl glycidyl ether?
The EC number is 920-007-0.
Is Benzyl glycidyl ether a canonicalized compound?
Yes, it is canonicalized according to PubChem.