What is the molecular formula of Benzenamine, 3-(1-piperidinylmethyl)-?
The molecular formula is C12H18N2.
What are the synonyms for Benzenamine, 3-(1-piperidinylmethyl)-?
The synonyms include 3-(Piperidin-1-ylmethyl)aniline, 93138-55-7, 3-(1-Piperidylmethyl)aniline, [3-(Piperidin-1-ylmethyl)phenyl]amine, and 3-Piperidin-1-ylmethyl-aniline.
What is the molecular weight of Benzenamine, 3-(1-piperidinylmethyl)-?
The molecular weight is 190.28 g/mol.
What is the IUPAC name of Benzenamine, 3-(1-piperidinylmethyl)-?
The IUPAC name is 3-(piperidin-1-ylmethyl)aniline.
What is the InChI of Benzenamine, 3-(1-piperidinylmethyl)-?
The InChI is InChI=1S/C12H18N2/c13-12-6-4-5-11(9-12)10-14-7-2-1-3-8-14/h4-6,9H,1-3,7-8,10,13H2.
What is the InChIKey of Benzenamine, 3-(1-piperidinylmethyl)-?
The InChIKey is SEJNYLBEEMVJNN-UHFFFAOYSA-N.
What is the Canonical SMILES of Benzenamine, 3-(1-piperidinylmethyl)-?
The Canonical SMILES is C1CCN(CC1)CC2=CC(=CC=C2)N.
What is the CAS number of Benzenamine, 3-(1-piperidinylmethyl)-?
The CAS number is 93138-55-7.
Is Benzenamine, 3-(1-piperidinylmethyl)- the compound canonicalized?
Yes, it is canonicalized.
※ Please kindly note that our products are for research use only.