What is the product name of the chemical with CAS number 13232-26-3?
The product name is Batyl stearate.
What are some synonyms of Batyl stearate?
Some synonyms of Batyl stearate include Stearic acid, 2-(octadecyloxy)-3-hydroxypropyl ester.
What is the IUPAC name of Batyl stearate?
The IUPAC name is (3-Hydroxy-2-octadecoxypropyl) octadecanoate.
What is the molecular weight of Batyl stearate?
The molecular weight is 611.03.
What is the molecular formula of Batyl stearate?
The molecular formula is C39H78O4.
What is the structure of Batyl stearate represented by SMILES notation?
The structure of Batyl stearate in SMILES notation is CCCCCCCCCCCCCCCCCCOC(CO)COC(=O)CCCCCCCCCCCCCCCCC.
What is the InChI key of Batyl stearate?
The InChI key is InChI=1S/C39H78O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42-38(36-40)37-43-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h38,40H,3-37H2,1-2H3.
What is the percentage of actives present in Batyl stearate?
The percentage of actives is 95%.
What is the physical state of Batyl stearate?
The physical state is solid.
What is the typical application of Batyl stearate?
The typical application of Batyl stearate is as an emollient.