What is the PubChem CID for Annatto?
PubChem CID 6537492.
What is the molecular formula of Annatto?
The molecular formula of Annatto is C24H28O4.
What is the molecular weight of Annatto?
The molecular weight of Annatto is 380.5 g/mol.
What is the IUPAC name of Annatto?
The IUPAC name of Annatto is (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-4,8,13,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioic acid.
What is the InChI of Annatto?
The InChI of Annatto is InChI=1S/C24H28O4/c1-19(11-7-13-21(3)15-17-23(25)26)9-5-6-10-20(2)12-8-14-22(4)16-18-24(27)28/h5-18H,1-4H3,(H,25,26)(H,27,28)/b6-5+,11-7+,12-8+,17-15+,18-16+,19-9+,20-10+,21-13-,22-14+.
What is the InChIKey of Annatto?
The InChIKey of Annatto is ZVKOASAVGLETCT-LRRSNBNMSA-N.
What is the canonical SMILES of Annatto?
The canonical SMILES of Annatto is CC(=CC=CC=C(C)C=CC=C(C)C=CC(=O)O)C=CC=C(C)C=CC(=O)O.
What is the isomeric SMILES of Annatto?
The isomeric SMILES of Annatto is C/C(=C\C=C\C=C(/C)\C=C\C=C(\C)/C=C/C(=O)O)/C=C/C=C(\C)/C=C/C(=O)O.
What is the CAS number of Annatto?
The CAS number of Annatto is 1393-63-1.
What is the FEMA number of Annatto?
The FEMA number of Annatto is 2104.