What is the molecular formula of 4-Aminostyrene?
The molecular formula of 4-Aminostyrene is C8H9N.
What is the molecular weight of 4-Aminostyrene?
The molecular weight of 4-Aminostyrene is 119.16 g/mol.
What are the synonyms for 4-Aminostyrene?
The synonyms for 4-Aminostyrene are 4-Vinylaniline and p-Aminostyrene.
What is the IUPAC name of 4-Aminostyrene?
The IUPAC name of 4-Aminostyrene is 4-ethenylaniline.
What is the InChI of 4-Aminostyrene?
The InChI of 4-Aminostyrene is InChI=1S/C8H9N/c1-2-7-3-5-8(9)6-4-7/h2-6H,1,9H2.
What is the InChIKey of 4-Aminostyrene?
The InChIKey of 4-Aminostyrene is LBSXSAXOLABXMF-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Aminostyrene?
The canonical SMILES of 4-Aminostyrene is C=CC1=CC=C(C=C1)N.
What is the CAS number of 4-Aminostyrene?
The CAS number of 4-Aminostyrene is 1520-21-4.
How many hydrogen bond donor count does 4-Aminostyrene have?
4-Aminostyrene has 1 hydrogen bond donor count.