What is the molecular formula of Allyltriisopropylsilane?
The molecular formula of Allyltriisopropylsilane is C12H26Si.
What is the molecular weight of Allyltriisopropylsilane?
The molecular weight of Allyltriisopropylsilane is 198.42 g/mol.
What is the IUPAC name of Allyltriisopropylsilane?
The IUPAC name of Allyltriisopropylsilane is tri(propan-2-yl)-prop-2-enylsilane.
What is the InChI of Allyltriisopropylsilane?
The InChI of Allyltriisopropylsilane is InChI=1S/C12H26Si/c1-8-9-13(10(2)3,11(4)5)12(6)7/h8,10-12H,1,9H2,2-7H3.
What is the InChIKey of Allyltriisopropylsilane?
The InChIKey of Allyltriisopropylsilane is AKQHUJRZKBYZLC-UHFFFAOYSA-N.
What is the canonical SMILES notation of Allyltriisopropylsilane?
The canonical SMILES notation of Allyltriisopropylsilane is CC(C)[Si](CC=C)(C(C)C)C(C)C.
What is the CAS number of Allyltriisopropylsilane?
The CAS number of Allyltriisopropylsilane is 24400-84-8.
What is the EC number of Allyltriisopropylsilane?
The EC number of Allyltriisopropylsilane is 625-488-8.
What is the molecular weight of Allyltriisopropylsilane in exact mass?
The exact mass of Allyltriisopropylsilane is 198.180377364 g/mol.
Is Allyltriisopropylsilane a canonicalized compound?
Yes, Allyltriisopropylsilane is a canonicalized compound according to PubChem.