What is the molecular formula of Agar?
The molecular formula of Agar is C14H24O9.
What is the molecular weight of Agar?
The molecular weight of Agar is 336.33 g/mol.
What is Agar used for?
Agar is used as a gel in the preparation of solid culture media for microorganisms, as a bulk laxative, in making emulsions, and as a supporting medium for immunodiffusion and immunoelectrophoresis.
What is the IUPAC name of Agar?
The IUPAC name of Agar is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol.
What is the InChIKey of Agar?
The InChIKey of Agar is GYYDPBCUIJTIBM-DYOGSRDZSA-N.
What is the Canonical SMILES of Agar?
The Canonical SMILES of Agar is CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O.
What is the CAS number of Agar?
The CAS number of Agar is 9002-18-0.
What is the EC number of Agar?
The EC number of Agar is 232-658-1.
What is the FEMA number of Agar?
The FEMA number of Agar is 2012.
What is the formal charge of Agar?
The formal charge of Agar is 0.