What is the molecular formula of 9-Phenylanthracene?
The molecular formula of 9-Phenylanthracene is C20H14.
What is the molecular weight of 9-Phenylanthracene?
The molecular weight of 9-Phenylanthracene is 254.3 g/mol.
What is the IUPAC name of 9-Phenylanthracene?
The IUPAC name of 9-Phenylanthracene is 9-phenylanthracene.
What is the InChI of 9-Phenylanthracene?
The InChI of 9-Phenylanthracene is InChI=1S/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H.
What is the InChIKey of 9-Phenylanthracene?
The InChIKey of 9-Phenylanthracene is LUBXLGUQZVKOFP-UHFFFAOYSA-N.
What is the canonical SMILES of 9-Phenylanthracene?
The canonical SMILES of 9-Phenylanthracene is C1=CC=C(C=C1)C2=C3C=CC=CC3=CC4=CC=CC=C42.
What is the CAS number of 9-Phenylanthracene?
The CAS number of 9-Phenylanthracene is 602-55-1.
What is the European Community (EC) number of 9-Phenylanthracene?
The European Community (EC) number of 9-Phenylanthracene is 210-019-8.
What is the UNII of 9-Phenylanthracene?
The UNII of 9-Phenylanthracene is DC63Z5S1UP.
Can 9-Phenylanthracene act as a hydrogen bond donor?
No, 9-Phenylanthracene does not act as a hydrogen bond donor as it has a hydrogen bond donor count of 0.