What is the PubChem CID for 9-Bromoanthracene?
The PubChem CID for 9-Bromoanthracene is 74062.
What is the molecular formula of 9-Bromoanthracene?
The molecular formula of 9-Bromoanthracene is C14H9Br.
What is the molecular weight of 9-Bromoanthracene?
The molecular weight of 9-Bromoanthracene is 257.12 g/mol.
What is the IUPAC name of 9-Bromoanthracene?
The IUPAC name of 9-Bromoanthracene is 9-bromoanthracene.
What is the InChI of 9-Bromoanthracene?
The InChI of 9-Bromoanthracene is InChI=1S/C14H9Br/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H.
What is the InChIKey of 9-Bromoanthracene?
The InChIKey of 9-Bromoanthracene is ZIRVQSRSPDUEOJ-UHFFFAOYSA-N.
What is the canonical SMILES of 9-Bromoanthracene?
The canonical SMILES of 9-Bromoanthracene is C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Br.
What is the CAS number of 9-Bromoanthracene?
The CAS number of 9-Bromoanthracene is 1564-64-3.
What is the Hydrogen Bond Donor Count of 9-Bromoanthracene?
The Hydrogen Bond Donor Count of 9-Bromoanthracene is 0.
Is 9-Bromoanthracene a canonicalized compound?
Yes, 9-Bromoanthracene is a canonicalized compound according to PubChem.