What is the PubChem CID for 9,10-Dihydroanthracene?
The PubChem CID for 9,10-Dihydroanthracene is 11940.
What is the molecular formula of 9,10-Dihydroanthracene?
The molecular formula of 9,10-Dihydroanthracene is C14H12.
What is the molecular weight of 9,10-Dihydroanthracene?
The molecular weight of 9,10-Dihydroanthracene is 180.24 g/mol.
What is the IUPAC name of 9,10-Dihydroanthracene?
The IUPAC name of 9,10-Dihydroanthracene is 9,10-dihydroanthracene.
What is the InChI of 9,10-Dihydroanthracene?
The InChI of 9,10-Dihydroanthracene is InChI=1S/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2.
What is the InChIKey of 9,10-Dihydroanthracene?
The InChIKey of 9,10-Dihydroanthracene is WPDAVTSOEQEGMS-UHFFFAOYSA-N.
What is the canonical SMILES of 9,10-Dihydroanthracene?
The canonical SMILES of 9,10-Dihydroanthracene is C1C2=CC=CC=C2CC3=CC=CC=C31.
What is the CAS number for 9,10-Dihydroanthracene?
The CAS number for 9,10-Dihydroanthracene is 613-31-0.
What is the XLogP3 value of 9,10-Dihydroanthracene?
The XLogP3 value of 9,10-Dihydroanthracene is 4.2.