What is the molecular formula of 8-Methoxyquinoline?
The molecular formula of 8-Methoxyquinoline is C10H9NO.
What is the molecular weight of 8-Methoxyquinoline?
The molecular weight of 8-Methoxyquinoline is 159.18 g/mol.
What is the IUPAC name of 8-Methoxyquinoline?
The IUPAC name of 8-Methoxyquinoline is 8-methoxyquinoline.
What is the InChI of 8-Methoxyquinoline?
The InChI of 8-Methoxyquinoline is InChI=1S/C10H9NO/c1-12-9-6-2-4-8-5-3-7-11-10(8)9/h2-7H,1H3.
What is the InChIKey of 8-Methoxyquinoline?
The InChIKey of 8-Methoxyquinoline is ZLKGGEBOALGXJZ-UHFFFAOYSA-N.
What is the canonical SMILES of 8-Methoxyquinoline?
The canonical SMILES of 8-Methoxyquinoline is COC1=CC=CC2=C1N=CC=C2.
What is the CAS number of 8-Methoxyquinoline?
The CAS number of 8-Methoxyquinoline is 938-33-0.
What is the European Community (EC) number of 8-Methoxyquinoline?
The European Community (EC) number of 8-Methoxyquinoline is 213-341-7.
What is the ChEMBL ID of 8-Methoxyquinoline?
The ChEMBL ID of 8-Methoxyquinoline is CHEMBL300509.
Is 8-Methoxyquinoline a canonicalized compound?
Yes, 8-Methoxyquinoline is a canonicalized compound according to PubChem.