What is the molecular formula of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The molecular formula is C7H13Cl2N5O.
What are the synonyms of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The synonyms are 69113-63-9, (+/-)-6-Methyl-5,6,7,8-tetrahydropterine dihydrochloride, 2-Amino-6-methyl-5,6,7,8-tetrahydropteridin-4(1H)-one dihydrochloride, and more.
What is the molecular weight of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The molecular weight is 254.11 g/mol.
What is the parent compound of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The parent compound is 6-Methyltetrahydropterin.
What are the component compounds of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The component compound is 6-Methyltetrahydropterin and Hydrochloric Acid.
What is the InChI of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The InChI is InChI=1S/C7H11N5O.2ClH/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5;;/h3,10H,2H2,1H3,(H4,8,9,11,12,13);2*1H
What is the InChIKey of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The InChIKey is MKQLORLCFAZASZ-UHFFFAOYSA-N.
What is the Canonical SMILES of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The Canonical SMILES is CC1CNC2=C(N1)C(=O)NC(=N2)N.Cl.Cl.
What is the CAS number of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The CAS number is 69113-63-9.
What is the hydrogen bond acceptor count of (+/-)-6-Methyl-5,6,7,8-Tetrahydropterine Dihydrochloride?
The hydrogen bond acceptor count is 4.
※ Please kindly note that our products are for research use only.