What is the molecular formula of 6-Dehydroestrone?
The molecular formula of 6-Dehydroestrone is C18H20O2.
What is the molecular weight of 6-Dehydroestrone?
The molecular weight of 6-Dehydroestrone is 268.3 g/mol.
What is the IUPAC name of 6-Dehydroestrone?
The IUPAC name of 6-Dehydroestrone is (8R,9S,13S,14S)-3-hydroxy-13-methyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-one.
What is the Canonical SMILES of 6-Dehydroestrone?
The Canonical SMILES of 6-Dehydroestrone is CC12CCC3C(C1CCC2=O)C=CC4=C3C=CC(=C4)O.
What is the CAS number of 6-Dehydroestrone?
The CAS number of 6-Dehydroestrone is 2208-12-0.
What is the European Community (EC) number of 6-Dehydroestrone?
The European Community (EC) number of 6-Dehydroestrone is 636-647-6.
What is the KEGG ID of 6-Dehydroestrone?
The KEGG ID of 6-Dehydroestrone is C14650.
What is the hydrogen bond donor count of 6-Dehydroestrone?
The hydrogen bond donor count of 6-Dehydroestrone is 1.
What is the hydrogen bond acceptor count of 6-Dehydroestrone?
The hydrogen bond acceptor count of 6-Dehydroestrone is 2.
What is the topological polar surface area of 6-Dehydroestrone?
The topological polar surface area of 6-Dehydroestrone is 37.3Ų.