What is the CID of 5-Methoxy-1-indanone according to PubChem?
CID: 78787
What is the molecular formula of 5-Methoxy-1-indanone?
Molecular Formula: C10H10O2
What is the molecular weight of 5-Methoxy-1-indanone?
Molecular Weight: 162.18 g/mol
What is the IUPAC name of 5-Methoxy-1-indanone?
IUPAC Name: 5-methoxy-2,3-dihydroinden-1-one
What is the InChI code of 5-Methoxy-1-indanone?
InChI: InChI=1S/C10H10O2/c1-12-8-3-4-9-7(6-8)2-5-10(9)11/h3-4,6H,2,5H2,1H3
What is the InChIKey of 5-Methoxy-1-indanone?
InChIKey: QOPRWBRNMPANKN-UHFFFAOYSA-N
What is the canonical SMILES of 5-Methoxy-1-indanone?
Canonical SMILES: COC1=CC2=C(C=C1)C(=O)CC2
What is the CAS number of 5-Methoxy-1-indanone?
CAS Number: 5111-70-6
What is the European Community (EC) Number of 5-Methoxy-1-indanone?
EC Number: 225-838-6
What is the XLogP3-AA value of 5-Methoxy-1-indanone?
XLogP3-AA: 1.6