What is the PubChem CID of 5-Hexenyltriethoxysilane?
The PubChem CID of 5-Hexenyltriethoxysilane is 22145149.
What is the molecular formula of 5-Hexenyltriethoxysilane?
The molecular formula of 5-Hexenyltriethoxysilane is C12H26O3Si.
What are some synonyms of 5-Hexenyltriethoxysilane?
Some synonyms of 5-Hexenyltriethoxysilane are triethoxy(hex-5-enyl)silane and TRIETHOXY(HEX-5-EN-1-YL)SILANE.
What is the molecular weight of 5-Hexenyltriethoxysilane?
The molecular weight of 5-Hexenyltriethoxysilane is 246.42 g/mol.
What is the IUPAC name of 5-Hexenyltriethoxysilane?
The IUPAC name of 5-Hexenyltriethoxysilane is triethoxy(hex-5-enyl)silane.
What is the InChI of 5-Hexenyltriethoxysilane?
The InChI of 5-Hexenyltriethoxysilane is InChI=1S/C12H26O3Si/c1-5-9-10-11-12-16(13-6-2,14-7-3)15-8-4/h5H,1,6-12H2,2-4H3.
What is the InChIKey of 5-Hexenyltriethoxysilane?
The InChIKey of 5-Hexenyltriethoxysilane is RKYSDIOEHLMYRS-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Hexenyltriethoxysilane?
The canonical SMILES of 5-Hexenyltriethoxysilane is CCO[Si](CCCCC=C)(OCC)OCC.
What is the CAS number of 5-Hexenyltriethoxysilane?
The CAS number of 5-Hexenyltriethoxysilane is 52034-14-7.
What is the European Community (EC) number of 5-Hexenyltriethoxysilane?
The European Community (EC) number of 5-Hexenyltriethoxysilane is 610-772-6.