What is the molecular formula of 5-Chlorobenzofuran-3-one?
The molecular formula of 5-Chlorobenzofuran-3-one is C8H5ClO2.
When was 5-Chlorobenzofuran-3-one first created?
5-Chlorobenzofuran-3-one was first created on 2005-09-10.
How is the IUPAC name of 5-Chlorobenzofuran-3-one computed?
The IUPAC name of 5-Chlorobenzofuran-3-one is computed by Lexichem TK 2.7.0.
What is the Canonical SMILES of 5-Chlorobenzofuran-3-one?
The Canonical SMILES of 5-Chlorobenzofuran-3-one is C1C(=O)C2=C(O1)C=CC(=C2)Cl.
What is the molecular weight of 5-Chlorobenzofuran-3-one?
The molecular weight of 5-Chlorobenzofuran-3-one is 168.57 g/mol.
How many hydrogen bond donor counts does 5-Chlorobenzofuran-3-one have?
5-Chlorobenzofuran-3-one has 0 hydrogen bond donor counts.
What is the exact mass of 5-Chlorobenzofuran-3-one?
The exact mass of 5-Chlorobenzofuran-3-one is 167.9978071 g/mol.
What is the topological polar surface area of 5-Chlorobenzofuran-3-one?
The topological polar surface area of 5-Chlorobenzofuran-3-one is 26.3 Ų.
How many heavy atoms are present in 5-Chlorobenzofuran-3-one?
There are 11 heavy atoms in 5-Chlorobenzofuran-3-one.
Is 5-Chlorobenzofuran-3-one a canonicalized compound?
Yes, 5-Chlorobenzofuran-3-one is a canonicalized compound.