5-Bromo-2-(cyclopropylmethoxy)pyridine can be used to synthesize practical preparations of α(v)β(3) antagonists.
What is the molecular formula of the compound?
The molecular formula of the compound is C9H10BrNO.
What are the synonyms for the compound?
The synonyms for the compound are 5-BROMO-2-(CYCLOPROPYLMETHOXY)PYRIDINE, 494772-02-0, Pyridine, 5-bromo-2-(cyclopropylmethoxy)-, SCHEMBL1390734, and DTXSID20619996.
What is the molecular weight of the compound?
The molecular weight of the compound is 228.09 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-bromo-2-(cyclopropylmethoxy)pyridine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H10BrNO/c10-8-3-4-9(11-5-8)12-6-7-1-2-7/h3-5,7H,1-2,6H2.
What is the InChIKey of the compound?
The InChIKey of the compound is FXLHFKZNQOIRGG-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1CC1COC2=NC=C(C=C2)Br.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.6.
How many hydrogen bond donor count does the compound have?
The compound has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 2 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.