What is the PubChem CID of 4-tert-Octylphenol?
The PubChem CID of 4-tert-Octylphenol is 8814.
What is the molecular formula of 4-tert-Octylphenol?
The molecular formula of 4-tert-Octylphenol is C14H22O.
What is the molecular weight of 4-tert-Octylphenol?
The molecular weight of 4-tert-Octylphenol is 206.32 g/mol.
What is the IUPAC name of 4-tert-Octylphenol?
The IUPAC name of 4-tert-Octylphenol is 4-(2,4,4-trimethylpentan-2-yl)phenol.
What is the InChI of 4-tert-Octylphenol?
The InChI of 4-tert-Octylphenol is "InChI=1S/C14H22O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h6-9,15H,10H2,1-5H3".
What is the InChIKey of 4-tert-Octylphenol?
The InChIKey of 4-tert-Octylphenol is "ISAVYTVYFVQUDY-UHFFFAOYSA-N".
What is the canonical SMILES of 4-tert-Octylphenol?
The canonical SMILES of 4-tert-Octylphenol is "CC(C)(C)CC(C)(C)C1=CC=C(C=C1)O".
What is the CAS number of 4-tert-Octylphenol?
The CAS number of 4-tert-Octylphenol is 140-66-9.
What is the ChEBI ID of 4-tert-Octylphenol?
The ChEBI ID of 4-tert-Octylphenol is not mentioned in the reference.
What is the XLogP3 value of 4-tert-Octylphenol?
The XLogP3 value of 4-tert-Octylphenol is 5.