What is the molecular formula of 4-N-Butoxybenzoic acid?
The molecular formula of 4-N-Butoxybenzoic acid is C11H14O3.
What is the molecular weight of 4-N-Butoxybenzoic acid?
The molecular weight of 4-N-Butoxybenzoic acid is 194.23 g/mol.
What is the IUPAC name of 4-N-Butoxybenzoic acid?
The IUPAC name of 4-N-Butoxybenzoic acid is 4-butoxybenzoic acid.
What is the InChIkey of 4-N-Butoxybenzoic acid?
The InChIkey of 4-N-Butoxybenzoic acid is LAUFPZPAKULAGB-UHFFFAOYSA-N.
What is the canonical SMILES representation of 4-N-Butoxybenzoic acid?
The canonical SMILES representation of 4-N-Butoxybenzoic acid is CCCCOC1=CC=C(C=C1)C(=O)O.
What is the CAS number of 4-N-Butoxybenzoic acid?
The CAS number of 4-N-Butoxybenzoic acid is 1498-96-0.
What is the XLogP3 value of 4-N-Butoxybenzoic acid?
The XLogP3 value of 4-N-Butoxybenzoic acid is 3.6.
How many hydrogen bond donor counts does 4-N-Butoxybenzoic acid have?
4-N-Butoxybenzoic acid has 1 hydrogen bond donor count.
How many rotatable bond counts does 4-N-Butoxybenzoic acid have?
4-N-Butoxybenzoic acid has 5 rotatable bond counts.
Is 4-N-Butoxybenzoic acid a canonicalized compound?
Yes, 4-N-Butoxybenzoic acid is a canonicalized compound.