What is the molecular formula of 4-Hydroxyindole?
The molecular formula is C8H7NO.
What is the molecular weight of 4-Hydroxyindole?
The molecular weight is 133.15 g/mol.
What is the IUPAC name of 4-Hydroxyindole?
The IUPAC name is 1H-indol-4-ol.
What is the InChI of 4-Hydroxyindole?
The InChI is InChI=1S/C8H7NO/c10-8-3-1-2-7-6(8)4-5-9-7/h1-5,9-10H.
What is the Canonical SMILES of 4-Hydroxyindole?
The Canonical SMILES is C1=CC2=C(C=CN2)C(=C1)O.
What is the CAS number of 4-Hydroxyindole?
The CAS number is 2380-94-1.
What is the XLogP3 value of 4-Hydroxyindole?
The XLogP3 value is 2.4.
How many hydrogen bond donor counts does 4-Hydroxyindole have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Hydroxyindole have?
It has 1 hydrogen bond acceptor count.
How many rotatable bond counts does 4-Hydroxyindole have?
It has 0 rotatable bond counts.