What is the molecular formula of 4-Bromophenetole?
The molecular formula of 4-Bromophenetole is C8H9BrO.
What is the molecular weight of 4-Bromophenetole?
The molecular weight of 4-Bromophenetole is 201.06 g/mol.
What is the IUPAC name of 4-Bromophenetole?
The IUPAC name of 4-Bromophenetole is 1-bromo-4-ethoxybenzene.
What is the InChI of 4-Bromophenetole?
The InChI of 4-Bromophenetole is InChI=1S/C8H9BrO/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3.
What is the InChIKey of 4-Bromophenetole?
The InChIKey of 4-Bromophenetole is WVUYYXUATWMVIT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromophenetole?
The canonical SMILES of 4-Bromophenetole is CCOC1=CC=C(C=C1)Br.
What is the CAS number of 4-Bromophenetole?
The CAS number of 4-Bromophenetole is 588-96-5.
What is the XLogP3 value of 4-Bromophenetole?
The XLogP3 value of 4-Bromophenetole is 2.9.
What is the hydrogen bond donor count of 4-Bromophenetole?
The hydrogen bond donor count of 4-Bromophenetole is 0.
Is 4-Bromophenetole a canonicalized compound?
Yes, 4-Bromophenetole is a canonicalized compound.