What is the molecular formula of 4-Bromo-2-ethylpyridine?
The molecular formula of 4-Bromo-2-ethylpyridine is C7H8BrN.
What is the molecular weight of 4-Bromo-2-ethylpyridine?
The molecular weight of 4-Bromo-2-ethylpyridine is 186.05 g/mol.
What is the IUPAC name of 4-Bromo-2-ethylpyridine?
The IUPAC name of 4-Bromo-2-ethylpyridine is 4-bromo-2-ethylpyridine.
What is the InChI of 4-Bromo-2-ethylpyridine?
The InChI of 4-Bromo-2-ethylpyridine is InChI=1S/C7H8BrN/c1-2-7-5-6(8)3-4-9-7/h3-5H,2H2,1H3.
What is the InChIKey of 4-Bromo-2-ethylpyridine?
The InChIKey of 4-Bromo-2-ethylpyridine is TVRGNBFSOZCSSE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-ethylpyridine?
The canonical SMILES of 4-Bromo-2-ethylpyridine is CCC1=NC=CC(=C1)Br.
What is the CAS number of 4-Bromo-2-ethylpyridine?
The CAS number of 4-Bromo-2-ethylpyridine is 156761-88-5.
What is the European Community (EC) Number of 4-Bromo-2-ethylpyridine?
The European Community (EC) Number of 4-Bromo-2-ethylpyridine is 868-499-5.
What is the DSSTox Substance ID of 4-Bromo-2-ethylpyridine?
The DSSTox Substance ID of 4-Bromo-2-ethylpyridine is DTXSID60624685.
Is 4-Bromo-2-ethylpyridine a canonicalized compound?
Yes, 4-Bromo-2-ethylpyridine is a canonicalized compound according to PubChem.