The molecular weight of the keyword is 268.3 g/mol.
What are the synonyms of the keyword?
The synonyms of the keyword are: 472-41-3 4-(2,2,4-trimethylchroman-4-yl)phenol Dianin's compound Phenol, 4-(3,4-dihydro-2,2,4-trimethyl-2H-1-benzopyran-4-yl)- 4-p-Hydroxyphenyl-2,2,4-trimethylchroman
What is the IUPAC name of the keyword?
The IUPAC name of the keyword is 4-(2,2,4-trimethyl-3H-chromen-4-yl)phenol.
What is the InChI of the keyword?
The InChI of the keyword is InChI=1S/C18H20O2/c1-17(2)12-18(3,13-8-10-14(19)11-9-13)15-6-4-5-7-16(15)20-17/h4-11,19H,12H2,1-3H3.
What is the InChIKey of the keyword?
The InChIKey of the keyword is KXYDGGNWZUHESZ-UHFFFAOYSA-N.
What is the canonical SMILES of the keyword?
The canonical SMILES of the keyword is CC1(CC(C2=CC=CC=C2O1)(C)C3=CC=C(C=C3)O).
What is the CAS number of the keyword?
The CAS number of the keyword is 472-41-3.
What is the UNII of the keyword?
The UNII of the keyword is 90766708Z6.
What is the XLogP3-AA value of the keyword?
The XLogP3-AA value of the keyword is 4.5.
※ Please kindly note that our products are for research use only.