What is the molecular formula of 3-Phenoxymandelic acid?
The molecular formula of 3-Phenoxymandelic acid is C14H12O4.
What are the synonyms for 3-Phenoxymandelic acid?
The synonyms for 3-Phenoxymandelic acid are 66637-86-3, 2-hydroxy-2-(3-phenoxyphenyl)acetic acid, and MFCD03789126.
What is the molecular weight of 3-Phenoxymandelic acid?
The molecular weight of 3-Phenoxymandelic acid is 244.24 g/mol.
When was 3-Phenoxymandelic acid created?
3-Phenoxymandelic acid was created on July 19, 2005.
When was 3-Phenoxymandelic acid last modified?
3-Phenoxymandelic acid was last modified on October 21, 2023.
What is the IUPAC name of 3-Phenoxymandelic acid?
The IUPAC name of 3-Phenoxymandelic acid is 2-hydroxy-2-(3-phenoxyphenyl)acetic acid.
What is the InChI of 3-Phenoxymandelic acid?
The InChI of 3-Phenoxymandelic acid is InChI=1S/C14H12O4/c15-13(14(16)17)10-5-4-8-12(9-10)18-11-6-2-1-3-7-11/h1-9,13,15H,(H,16,17).
What is the InChIKey of 3-Phenoxymandelic acid?
The InChIKey of 3-Phenoxymandelic acid is FPUCYPXKIFVDSD-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Phenoxymandelic acid?
The canonical SMILES of 3-Phenoxymandelic acid is C1=CC=C(C=C1)OC2=CC=CC(=C2)C(C(=O)O)O.
What is the hydrogen bond acceptor count of 3-Phenoxymandelic acid?
The hydrogen bond acceptor count of 3-Phenoxymandelic acid is 4.