What is the molecular formula of 3-Fluoro-2-methylphenylboronic acid?
The molecular formula of 3-Fluoro-2-methylphenylboronic acid is C7H8BFO2.
What are the synonyms for 3-Fluoro-2-methylphenylboronic acid?
The synonyms for 3-Fluoro-2-methylphenylboronic acid include 163517-61-1, 3-FLUORO-2-METHYLPHENYLBORONIC ACID, (3-fluoro-2-methylphenyl)boronic acid, 2-Methyl-3-fluoro-phenylboronic acid, and 3-FLUORO-2-METHYLBENZENEBORONIC ACID.
What is the molecular weight of 3-Fluoro-2-methylphenylboronic acid?
The molecular weight of 3-Fluoro-2-methylphenylboronic acid is 153.95 g/mol.
What is the IUPAC name of 3-Fluoro-2-methylphenylboronic acid?
The IUPAC name of 3-Fluoro-2-methylphenylboronic acid is (3-fluoro-2-methylphenyl)boronic acid.
What is the InChI of 3-Fluoro-2-methylphenylboronic acid?
The InChI of 3-Fluoro-2-methylphenylboronic acid is InChI=1S/C7H8BFO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,10-11H,1H3.
What is the InChIKey of 3-Fluoro-2-methylphenylboronic acid?
The InChIKey of 3-Fluoro-2-methylphenylboronic acid is NYBIUWJUWTUGFV-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-2-methylphenylboronic acid?
The canonical SMILES of 3-Fluoro-2-methylphenylboronic acid is B(C1=C(C(=CC=C1)F)C)(O)O.
What is the CAS number of 3-Fluoro-2-methylphenylboronic acid?
The CAS number of 3-Fluoro-2-methylphenylboronic acid is 163517-61-1.
What is the European Community (EC) number of 3-Fluoro-2-methylphenylboronic acid?
The European Community (EC) number of 3-Fluoro-2-methylphenylboronic acid is 811-070-4.
What is the hydrogen bond donor count of 3-Fluoro-2-methylphenylboronic acid?
The hydrogen bond donor count of 3-Fluoro-2-methylphenylboronic acid is 2.
※ Please kindly note that our products are for research use only.