What is the molecular formula of 3,5-Dibromobenzonitrile?
The molecular formula of 3,5-Dibromobenzonitrile is C7H3Br2N.
What is the molecular weight of 3,5-Dibromobenzonitrile?
The molecular weight of 3,5-Dibromobenzonitrile is 260.91 g/mol.
What is the IUPAC name of 3,5-Dibromobenzonitrile?
The IUPAC name of 3,5-Dibromobenzonitrile is 3,5-dibromobenzonitrile.
What is the InChI of 3,5-Dibromobenzonitrile?
The InChI of 3,5-Dibromobenzonitrile is InChI=1S/C7H3Br2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H.
What is the InChIKey of 3,5-Dibromobenzonitrile?
The InChIKey of 3,5-Dibromobenzonitrile is QUJGDNCWTBTBQD-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dibromobenzonitrile?
The canonical SMILES of 3,5-Dibromobenzonitrile is C1=C(C=C(C=C1Br)Br)C#N.
What is the CAS number of 3,5-Dibromobenzonitrile?
The CAS number of 3,5-Dibromobenzonitrile is 97165-77-0.
What is the EC number of 3,5-Dibromobenzonitrile?
The EC number of 3,5-Dibromobenzonitrile is 806-988-7.
What is the heavy atom count of 3,5-Dibromobenzonitrile?
The heavy atom count of 3,5-Dibromobenzonitrile is 10.
Is 3,5-Dibromobenzonitrile a canonicalized compound according to PubChem?
Yes, 3,5-Dibromobenzonitrile is a canonicalized compound according to PubChem.