What is the molecular formula of 3,4-Difluorobenzoic acid?
The molecular formula of 3,4-Difluorobenzoic acid is C7H4F2O2.
What is the molecular weight of 3,4-Difluorobenzoic acid?
The molecular weight of 3,4-Difluorobenzoic acid is 158.10 g/mol.
What is the IUPAC name of 3,4-Difluorobenzoic acid?
The IUPAC name of 3,4-Difluorobenzoic acid is 3,4-difluorobenzoic acid.
What is the InChI of 3,4-Difluorobenzoic acid?
The InChI of 3,4-Difluorobenzoic acid is InChI=1S/C7H4F2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11).
What is the InChIKey of 3,4-Difluorobenzoic acid?
The InChIKey of 3,4-Difluorobenzoic acid is FPENCTDAQQQKNY-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Difluorobenzoic acid?
The canonical SMILES of 3,4-Difluorobenzoic acid is C1=CC(=C(C=C1C(=O)O)F)F.
What is the CAS number of 3,4-Difluorobenzoic acid?
The CAS number of 3,4-Difluorobenzoic acid is 455-86-7.
What is the European Community (EC) number of 3,4-Difluorobenzoic acid?
The European Community (EC) number of 3,4-Difluorobenzoic acid is 207-249-6.
What is the UNII of 3,4-Difluorobenzoic acid?
The UNII of 3,4-Difluorobenzoic acid is J5J3RFV8N6.