What is the molecular formula of 2-Phenylpropionaldehyde?
The molecular formula of 2-Phenylpropionaldehyde is C9H10O.
What is the molecular weight of 2-Phenylpropionaldehyde?
The molecular weight of 2-Phenylpropionaldehyde is 134.17 g/mol.
What is the common name for 2-Phenylpropionaldehyde?
The common name for 2-Phenylpropionaldehyde is Hydratropic aldehyde.
What are some synonyms for 2-Phenylpropionaldehyde?
Some synonyms for 2-Phenylpropionaldehyde include 2-Phenylpropanal and Hydratropaldehyde.
Is 2-Phenylpropionaldehyde a natural product?
Yes, 2-Phenylpropionaldehyde is a natural product found in Swertia japonica, Gossypium hirsutum, and Vitex agnus-castus.
What is the IUPAC name of 2-Phenylpropionaldehyde?
The IUPAC name of 2-Phenylpropionaldehyde is 2-phenylpropanal.
What is the InChI of 2-Phenylpropionaldehyde?
The InChI of 2-Phenylpropionaldehyde is InChI=1S/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3.
What is the InChIKey of 2-Phenylpropionaldehyde?
The InChIKey of 2-Phenylpropionaldehyde is IQVAERDLDAZARL-UHFFFAOYSA-N.
What is the XLogP3-AA value of 2-Phenylpropionaldehyde?
The XLogP3-AA value of 2-Phenylpropionaldehyde is 1.9.
How many hydrogen bond donor counts are there in 2-Phenylpropionaldehyde?
There are 0 hydrogen bond donor counts in 2-Phenylpropionaldehyde.