What is the PubChem CID of 2-Hydroxynicotinaldehyde?
The PubChem CID of 2-Hydroxynicotinaldehyde is 7062196.
What is the molecular formula of 2-Hydroxynicotinaldehyde?
The molecular formula of 2-Hydroxynicotinaldehyde is C6H5NO2.
What is the molecular weight of 2-Hydroxynicotinaldehyde?
The molecular weight of 2-Hydroxynicotinaldehyde is 123.11 g/mol.
What is the IUPAC name of 2-Hydroxynicotinaldehyde?
The IUPAC name of 2-Hydroxynicotinaldehyde is 2-oxo-1H-pyridine-3-carbaldehyde.
What is the InChI of 2-Hydroxynicotinaldehyde?
The InChI of 2-Hydroxynicotinaldehyde is InChI=1S/C6H5NO2/c8-4-5-2-1-3-7-6(5)9/h1-4H,(H,7,9).
What is the InChIKey of 2-Hydroxynicotinaldehyde?
The InChIKey of 2-Hydroxynicotinaldehyde is DNTYEVWEOFZXFE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Hydroxynicotinaldehyde?
The canonical SMILES of 2-Hydroxynicotinaldehyde is C1=CNC(=O)C(=C1)C=O.
What is the CAS number of 2-Hydroxynicotinaldehyde?
The CAS number of 2-Hydroxynicotinaldehyde is 36404-89-4.
What is the European Community (EC) number of 2-Hydroxynicotinaldehyde?
The European Community (EC) number of 2-Hydroxynicotinaldehyde is 832-180-9.
Is 2-Hydroxynicotinaldehyde a canonicalized compound?
Yes, 2-Hydroxynicotinaldehyde is a canonicalized compound.