What is the molecular formula of 2-Ethoxynaphthalene?
The molecular formula of 2-Ethoxynaphthalene is C12H12O.
What is the molecular weight of 2-Ethoxynaphthalene?
The molecular weight of 2-Ethoxynaphthalene is 172.22 g/mol.
What is the IUPAC name of 2-Ethoxynaphthalene?
The IUPAC name of 2-Ethoxynaphthalene is 2-ethoxynaphthalene.
What is the InChI of 2-Ethoxynaphthalene?
The InChI of 2-Ethoxynaphthalene is InChI=1S/C12H12O/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,2H2,1H3.
What is the Canonical SMILES of 2-Ethoxynaphthalene?
The Canonical SMILES of 2-Ethoxynaphthalene is CCOC1=CC2=CC=CC=C2C=C1.
What is the CAS number of 2-Ethoxynaphthalene?
The CAS number of 2-Ethoxynaphthalene is 93-18-5.
What is the UNII of 2-Ethoxynaphthalene?
The UNII of 2-Ethoxynaphthalene is ZF3IS6G3R7.
What is the FEMA number of 2-Ethoxynaphthalene?
The FEMA number of 2-Ethoxynaphthalene is 2768.
What is the XLogP3 value of 2-Ethoxynaphthalene?
The XLogP3 value of 2-Ethoxynaphthalene is 3.8.