What is the molecular formula of 2-Bromoethyl benzoate?
The molecular formula of 2-Bromoethyl benzoate is C9H9BrO2.
What is the molecular weight of 2-Bromoethyl benzoate?
The molecular weight of 2-Bromoethyl benzoate is 229.07 g/mol.
What is the IUPAC name of 2-Bromoethyl benzoate?
The IUPAC name of 2-Bromoethyl benzoate is 2-bromoethyl benzoate.
What is the InChI of 2-Bromoethyl benzoate?
The InChI of 2-Bromoethyl benzoate is InChI=1S/C9H9BrO2/c10-6-7-12-9(11)8-4-2-1-3-5-8/h1-5H,6-7H2.
What is the InChIKey of 2-Bromoethyl benzoate?
The InChIKey of 2-Bromoethyl benzoate is KNBBDZULQFKSIE-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromoethyl benzoate?
The Canonical SMILES of 2-Bromoethyl benzoate is C1=CC=C(C=C1)C(=O)OCCBr.
What is the CAS number of 2-Bromoethyl benzoate?
The CAS number of 2-Bromoethyl benzoate is 939-54-8.
What is the European Community (EC) number of 2-Bromoethyl benzoate?
The European Community (EC) number of 2-Bromoethyl benzoate is 628-389-8.
What is the DSSTox Substance ID of 2-Bromoethyl benzoate?
The DSSTox Substance ID of 2-Bromoethyl benzoate is DTXSID30335150.
Is 2-Bromoethyl benzoate a canonicalized compound?
Yes, 2-Bromoethyl benzoate is a canonicalized compound.