2-Bromo-4-fluorophenyl isothiocyanate can synthesize 4- monosubstituted and 4,4- disubstituted 1,4- dihydro -3,1- benzoxazine -2- thione in high yield.
What is the PubChem CID of 2-Bromo-4-fluorophenyl isothiocyanate?
The PubChem CID of 2-Bromo-4-fluorophenyl isothiocyanate is 2736332.
What is the molecular formula of 2-Bromo-4-fluorophenyl isothiocyanate?
The molecular formula of 2-Bromo-4-fluorophenyl isothiocyanate is C7H3BrFNS.
What are some synonyms of 2-Bromo-4-fluorophenyl isothiocyanate?
Some synonyms of 2-Bromo-4-fluorophenyl isothiocyanate are 2-bromo-4-fluoro-1-isothiocyanatobenzene and Benzene, 2-bromo-4-fluoro-1-isothiocyanato-.
What is the molecular weight of 2-Bromo-4-fluorophenyl isothiocyanate?
The molecular weight of 2-Bromo-4-fluorophenyl isothiocyanate is 232.07 g/mol.
When was 2-Bromo-4-fluorophenyl isothiocyanate created?
2-Bromo-4-fluorophenyl isothiocyanate was created on July 19, 2005.
What is the IUPAC name of 2-Bromo-4-fluorophenyl isothiocyanate?
The IUPAC name of 2-Bromo-4-fluorophenyl isothiocyanate is 2-bromo-4-fluoro-1-isothiocyanatobenzene.
What is the InChI of 2-Bromo-4-fluorophenyl isothiocyanate?
The InChI of 2-Bromo-4-fluorophenyl isothiocyanate is InChI=1S/C7H3BrFNS/c8-6-3-5(9)1-2-7(6)10-4-11/h1-3H.
What is the InChIKey of 2-Bromo-4-fluorophenyl isothiocyanate?
The InChIKey of 2-Bromo-4-fluorophenyl isothiocyanate is SSLVXFSUADEZBQ-UHFFFAOYSA-N.
What is the SMILES representation of 2-Bromo-4-fluorophenyl isothiocyanate?
The SMILES representation of 2-Bromo-4-fluorophenyl isothiocyanate is C1=CC(=C(C=C1F)Br)N=C=S.
What is the CAS number of 2-Bromo-4-fluorophenyl isothiocyanate?
The CAS number of 2-Bromo-4-fluorophenyl isothiocyanate is 183995-72-4.
※ Please kindly note that our products are for research use only.