What is the molecular formula of 2-Bromo-1-phenylpropane?
The molecular formula of 2-Bromo-1-phenylpropane is C9H11Br.
What are the synonyms of 2-Bromo-1-phenylpropane?
The synonyms of 2-Bromo-1-phenylpropane are (2-Bromopropyl)benzene, 2-bromopropylbenzene, and Benzene, (2-bromopropyl)-.
What is the molecular weight of 2-Bromo-1-phenylpropane?
The molecular weight of 2-Bromo-1-phenylpropane is 199.09 g/mol.
When was 2-Bromo-1-phenylpropane created and modified?
2-Bromo-1-phenylpropane was created on March 27, 2005, and last modified on November 25, 2023.
What is the IUPAC name of 2-Bromo-1-phenylpropane?
The IUPAC name of 2-Bromo-1-phenylpropane is 2-bromopropylbenzene.
What is the InChI of 2-Bromo-1-phenylpropane?
The InChI of 2-Bromo-1-phenylpropane is InChI=1S/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What is the InChIKey of 2-Bromo-1-phenylpropane?
The InChIKey of 2-Bromo-1-phenylpropane is NVYOCAOZCSNIHR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-1-phenylpropane?
The canonical SMILES of 2-Bromo-1-phenylpropane is CC(CC1=CC=CC=C1)Br.
What is the CAS number of 2-Bromo-1-phenylpropane?
The CAS number of 2-Bromo-1-phenylpropane is 2114-39-8.
Does 2-Bromo-1-phenylpropane have any hydrogen bond donor or acceptor counts?
No, 2-Bromo-1-phenylpropane does not have any hydrogen bond donor or acceptor counts.