What is the molecular formula of 2-Benzyloxy-6-fluorophenylboronic acid?
The molecular formula of 2-Benzyloxy-6-fluorophenylboronic acid is C13H12BFO3.
What are the synonyms for 2-Benzyloxy-6-fluorophenylboronic acid?
The synonyms for 2-Benzyloxy-6-fluorophenylboronic acid include 1217500-53-2, 2-(Benzyloxy)-6-fluorophenylboronic acid, (2-fluoro-6-phenylmethoxyphenyl)boronic acid, and MFCD11617256.
What is the molecular weight of 2-Benzyloxy-6-fluorophenylboronic acid?
The molecular weight of 2-Benzyloxy-6-fluorophenylboronic acid is 246.04 g/mol.
What is the IUPAC name of 2-Benzyloxy-6-fluorophenylboronic acid?
The IUPAC name of 2-Benzyloxy-6-fluorophenylboronic acid is (2-fluoro-6-phenylmethoxyphenyl)boronic acid.
What is the InChI of 2-Benzyloxy-6-fluorophenylboronic acid?
The InChI of 2-Benzyloxy-6-fluorophenylboronic acid is InChI=1S/C13H12BFO3/c15-11-7-4-8-12(13(11)14(16)17)18-9-10-5-2-1-3-6-10/h1-8,16-17H,9H2.
What is the InChIKey of 2-Benzyloxy-6-fluorophenylboronic acid?
The InChIKey of 2-Benzyloxy-6-fluorophenylboronic acid is NBRVDQVRGXXXIE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Benzyloxy-6-fluorophenylboronic acid?
The canonical SMILES of 2-Benzyloxy-6-fluorophenylboronic acid is B(C1=C(C=CC=C1F)OCC2=CC=CC=C2)(O)O.
What is the CAS number of 2-Benzyloxy-6-fluorophenylboronic acid?
The CAS number of 2-Benzyloxy-6-fluorophenylboronic acid is 1217500-53-2.
What is the hydrogen bond donor count of 2-Benzyloxy-6-fluorophenylboronic acid?
The hydrogen bond donor count of 2-Benzyloxy-6-fluorophenylboronic acid is 2.
Is 2-Benzyloxy-6-fluorophenylboronic acid a canonicalized compound?
Yes, 2-Benzyloxy-6-fluorophenylboronic acid is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.