1072952-51-2 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,6-Difluoro-3-nitrophenylboronic acid is C6H4BF2NO4.
The molecular weight of 2,6-Difluoro-3-nitrophenylboronic acid is 202.91 g/mol.
The IUPAC name of 2,6-Difluoro-3-nitrophenylboronic acid is (2,6-difluoro-3-nitrophenyl)boronic acid.
The InChI of 2,6-Difluoro-3-nitrophenylboronic acid is InChI=1S/C6H4BF2NO4/c8-3-1-2-4(10(13)14)6(9)5(3)7(11)12/h1-2,11-12H.
The InChIKey of 2,6-Difluoro-3-nitrophenylboronic acid is SPEDPBJIXAVPMJ-UHFFFAOYSA-N.
The canonical SMILES representation of 2,6-Difluoro-3-nitrophenylboronic acid is B(C1=C(C=CC(=C1F)[N+](=O)[O-])F)(O)O.
The CAS number of 2,6-Difluoro-3-nitrophenylboronic acid is 1150114-28-5.
The hydrogen bond donor count of 2,6-Difluoro-3-nitrophenylboronic acid is 2.
The hydrogen bond acceptor count of 2,6-Difluoro-3-nitrophenylboronic acid is 6.
Yes, 2,6-Difluoro-3-nitrophenylboronic acid is a canonicalized compound according to PubChem.
Download
×