What is the molecular formula of 2,6-Diaminopurine?
The molecular formula of 2,6-Diaminopurine is C5H6N6.
What is the molecular weight of 2,6-Diaminopurine?
The molecular weight of 2,6-Diaminopurine is 150.14 g/mol.
What is the IUPAC name of 2,6-Diaminopurine?
The IUPAC name of 2,6-Diaminopurine is 7H-purine-2,6-diamine.
What is the InChI of 2,6-Diaminopurine?
The InChI of 2,6-Diaminopurine is InChI=1S/C5H6N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H5,6,7,8,9,10,11).
What is the InChIKey of 2,6-Diaminopurine?
The InChIKey of 2,6-Diaminopurine is MSSXOMSJDRHRMC-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Diaminopurine?
The canonical SMILES of 2,6-Diaminopurine is C1=NC2=NC(=NC(=C2N1)N)N.
What is the CAS number of 2,6-Diaminopurine?
The CAS number of 2,6-Diaminopurine is 1904-98-9.
What is the UNII of 2,6-Diaminopurine?
The UNII of 2,6-Diaminopurine is 49P95BAU4Z.
What is the ChEMBL ID of 2,6-Diaminopurine?
The ChEMBL ID of 2,6-Diaminopurine is CHEMBL388596.
What is the Wikipedia page for 2,6-Diaminopurine?
The Wikipedia page for 2,6-Diaminopurine can be found at "2,6-Diaminopurine".