What is the PubChem CID for 2,4-Pyridinediamine?
PubChem CID 68036.
What is the molecular formula of 2,4-Pyridinediamine?
The molecular formula is C5H7N3.
What is the molecular weight of 2,4-Pyridinediamine?
The molecular weight is 109.13 g/mol.
What is the IUPAC name of 2,4-Pyridinediamine?
The IUPAC name is pyridine-2,4-diamine.
What is the InChI of 2,4-Pyridinediamine?
The InChI is InChI=1S/C5H7N3/c6-4-1-2-8-5(7)3-4/h1-3H,(H4,6,7,8).
What is the InChIKey of 2,4-Pyridinediamine?
The InChIKey is IFFLKGMDBKQMAH-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Pyridinediamine?
The canonical SMILES is C1=CN=C(C=C1N)N.
What is the CAS number of 2,4-Pyridinediamine?
The CAS number is 461-88-1.
How many hydrogen bond donor counts does 2,4-Pyridinediamine have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,4-Pyridinediamine have?
It has 3 hydrogen bond acceptor counts.