What is the molecular formula of (10R)-10,14-Dimethylpentadecyl Isobutyrate?
The molecular formula is C21H42O2.
What is the molecular weight of (10R)-10,14-Dimethylpentadecyl Isobutyrate?
The molecular weight is 326.6 g/mol.
When was (10R)-10,14-Dimethylpentadecyl Isobutyrate created in PubChem?
It was created on 2007-02-09.
When was the last modification made to the information about (10R)-10,14-Dimethylpentadecyl Isobutyrate in PubChem?
The last modification was made on 2023-12-23.
What is the InChI of (10R)-10,14-Dimethylpentadecyl Isobutyrate?
The InChI is InChI=1S/C21H42O2/c1-18(2)14-13-16-20(5)15-11-9-7-6-8-10-12-17-23-21(22)19(3)4/h18-20H,6-17H2,1-5H3/t20-/m1/s1.
What is the InChIKey of (10R)-10,14-Dimethylpentadecyl Isobutyrate?
The InChIKey is WEUUVFYXSHQOIT-HXUWFJFHSA-N.
How many hydrogen bond donor counts does (10R)-10,14-Dimethylpentadecyl Isobutyrate have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of (10R)-10,14-Dimethylpentadecyl Isobutyrate?
The topological polar surface area is 26.3 Ų.
How many rotatable bond counts does (10R)-10,14-Dimethylpentadecyl Isobutyrate have?
It has 16 rotatable bond counts.
Is (10R)-10,14-Dimethylpentadecyl Isobutyrate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.