What is the molecular formula of (Carbomethoxy)decyldimethylmethoxysilane?
The molecular formula is C15H32O3Si.
What are the synonyms for (Carbomethoxy)decyldimethylmethoxysilane?
The synonyms are 10-(CARBOMETHOXY)DECYLDIMETHYLMETHOXYSILANE, 1211488-83-3, methyl 11-[methoxy(dimethyl)silyl]undecanoate, SCHEMBL753828, MFCD07778040.
What is the molecular weight of (Carbomethoxy)decyldimethylmethoxysilane?
The molecular weight is 288.50 g/mol.
What is the IUPAC name of (Carbomethoxy)decyldimethylmethoxysilane?
The IUPAC name is methyl 11-[methoxy(dimethyl)silyl]undecanoate.
What is the InChI of (Carbomethoxy)decyldimethylmethoxysilane?
The InChI is InChI=1S/C15H32O3Si/c1-17-15(16)13-11-9-7-5-6-8-10-12-14-19(3,4)18-2/h5-14H2,1-4H3.
What is the InChIKey of (Carbomethoxy)decyldimethylmethoxysilane?
The InChIKey is XRQMOODLXBBSRW-UHFFFAOYSA-N.
What is the canonical SMILES representation of (Carbomethoxy)decyldimethylmethoxysilane?
The canonical SMILES representation is COC(=O)CCCCCCCCCC[Si](C)(C)OC.
What is the hydrogen bond donor count of (Carbomethoxy)decyldimethylmethoxysilane?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of (Carbomethoxy)decyldimethylmethoxysilane?
The hydrogen bond acceptor count is 3.
What is the rotatable bond count of (Carbomethoxy)decyldimethylmethoxysilane?
The rotatable bond count is 13.
※ Please kindly note that our products are for research use only.