What is the molecular formula of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The molecular formula is C10H20OSi.
What is the molecular weight of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The molecular weight is 184.35 g/mol.
What is the IUPAC name of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The IUPAC name is [(1E)-buta-1,3-dienoxy]-tert-butyl-dimethylsilane.
What is the InChI of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The InChI is InChI=1S/C10H20OSi/c1-7-8-9-11-12(5,6)10(2,3)4/h7-9H,1H2,2-6H3/b9-8+.
What is the InChIKey of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The InChIKey is FOVNQHKJPKSUOU-CMDGGOBGSA-N.
What is the Canonical SMILES of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The Canonical SMILES is CC(C)(C)[Si](C)(C)OC=CC=C.
What is the Isomeric SMILES of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The Isomeric SMILES is CC(C)(C)[Si](C)(C)O/C=C/C=C.
What is the hydrogen bond donor count of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The hydrogen bond acceptor count is 1.
What is the rotatable bond count of 1-(t-Butyldimethylsiloxy)-1,3-butadiene?
The rotatable bond count is 4.