What is the molecular formula of 1-Phenoxy-2-propanol?
The molecular formula of 1-Phenoxy-2-propanol is C9H12O2.
What is the molecular weight of 1-Phenoxy-2-propanol?
The molecular weight of 1-Phenoxy-2-propanol is 152.19 g/mol.
What is the IUPAC name of 1-Phenoxy-2-propanol?
The IUPAC name of 1-Phenoxy-2-propanol is 1-phenoxypropan-2-ol.
What is the InChI of 1-Phenoxy-2-propanol?
The InChI of 1-Phenoxy-2-propanol is InChI=1S/C9H12O2/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3.
What is the InChIKey of 1-Phenoxy-2-propanol?
The InChIKey of 1-Phenoxy-2-propanol is IBLKWZIFZMJLFL-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Phenoxy-2-propanol?
The canonical SMILES of 1-Phenoxy-2-propanol is CC(COC1=CC=CC=C1)O.
What is the CAS number of 1-Phenoxy-2-propanol?
The CAS number of 1-Phenoxy-2-propanol is 770-35-4.
What is the UNII of 1-Phenoxy-2-propanol?
The UNII of 1-Phenoxy-2-propanol is 87CZY0NY1A.
What is the XLogP3 value of 1-Phenoxy-2-propanol?
The XLogP3 value of 1-Phenoxy-2-propanol is 1.7.
How many hydrogen bond donor and acceptor counts does 1-Phenoxy-2-propanol have?
1-Phenoxy-2-propanol has 1 hydrogen bond donor count and 2 hydrogen bond acceptor counts.