What is the molecular formula of 1-Methylguanine?
The molecular formula of 1-Methylguanine is C6H7N5O.
What is the molecular weight of 1-Methylguanine?
The molecular weight of 1-Methylguanine is 165.15 g/mol.
What is the IUPAC name of 1-Methylguanine?
The IUPAC name of 1-Methylguanine is 2-amino-1-methyl-7H-purin-6-one.
What is the InChI of 1-Methylguanine?
The InChI of 1-Methylguanine is InChI=1S/C6H7N5O/c1-11-5(12)3-4(9-2-8-3)10-6(11)7/h2H,1H3,(H2,7,10)(H,8,9).
What is the InChIKey of 1-Methylguanine?
The InChIKey of 1-Methylguanine is RFLVMTUMFYRZCB-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Methylguanine?
The canonical SMILES of 1-Methylguanine is CN1C(=O)C2=C(N=CN2)N=C1N.
What is the CAS number of 1-Methylguanine?
The CAS number of 1-Methylguanine is 938-85-2.
What is the European Community (EC) number of 1-Methylguanine?
The European Community (EC) number of 1-Methylguanine is 213-348-5.
What is the DSSTox Substance ID of 1-Methylguanine?
The DSSTox Substance ID of 1-Methylguanine is DTXSID4049377.