1-Ethyl ester methyl-3-methylimidazolium chloride

• CAS: 464916-25-4
• Catalog Number: ACM464916254
• Category: Functionized Ionic Liquids
• Molecular Weight: 206.6699
• Molecular Formula: C8H15ClN2O2

Custom Q&A

What is the molecular formula of 1-Ethyl ester methyl-3-methylimidazolium chloride?

The molecular formula is C8H13ClN2O2.

What is the molecular weight of 1-Ethyl ester methyl-3-methylimidazolium chloride?

The molecular weight is 204.65 g/mol.

What are the synonyms for 1-Ethyl ester methyl-3-methylimidazolium chloride?

Some synonyms include 1-(2-ethoxy-2-oxoethyl)-3-methyl-1H-imidazol-3-ium chloride and ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;chloride.

What is the IUPAC name of 1-Ethyl ester methyl-3-methylimidazolium chloride?

The IUPAC name is ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;chloride.

What is the InChI of 1-Ethyl ester methyl-3-methylimidazolium chloride?

The InChI is InChI=1S/C8H13N2O2.ClH/c1-3-12-8(11)6-10-5-4-9(2)7-10;/h4-5,7H,3,6H2,1-2H3;1H/q+1;/p-1.

How many hydrogen bond donor counts does 1-Ethyl ester methyl-3-methylimidazolium chloride have?

It has 0 hydrogen bond donor counts.

How many rotatable bond counts does 1-Ethyl ester methyl-3-methylimidazolium chloride have?

It has 4 rotatable bond counts.

What is the exact mass of 1-Ethyl ester methyl-3-methylimidazolium chloride?

The exact mass is 204.0665554 g/mol.

What is the topological polar surface area of 1-Ethyl ester methyl-3-methylimidazolium chloride?

The topological polar surface area is 35.1 Ų.

Is 1-Ethyl ester methyl-3-methylimidazolium chloride canonicalized?

Yes, the compound is canonicalized.